C11H8BrF2N5O2 — CID 80923986
N-(4-bromo-2,6-difluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine (PubChem CID 80923986) has the molecular formula C11H8BrF2N5O2 and a molecular weight of 360.12 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80923986 |
| Molecular Formula | C11H8BrF2N5O2 |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine |
| SMILES | NNc1ccc([N+](=O)[O-])c(Nc2c(F)cc(Br)cc2F)n1 |
| InChI | InChI=1S/C11H8BrF2N5O2/c12-5-3-6(13)10(7(14)4-5)17-11-8(19(20)21)1-2-9(16-11)18-15/h1-4H,15H2,(H2,16,17,18) |
| InChIKey | UYQQDCOUURTNFB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|