C12H9BrF2N4O2 — CID 107608390
2-N-(4-bromo-2,5-difluorophenyl)-6-N-methyl-3-nitropyridine-2,6-diamine (PubChem CID 107608390) has the molecular formula C12H9BrF2N4O2 and a molecular weight of 359.13 g/mol. Its IUPAC name is 2-N-(4-bromo-2,5-difluorophenyl)-6-N-methyl-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(4-bromo-2,5-difluorophenyl)-6-N-methyl-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 107608390 |
| Molecular Formula | C12H9BrF2N4O2 |
| Molecular Weight | 359.13 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 2-N-(4-bromo-2,5-difluorophenyl)-6-N-methyl-3-nitropyridine-2,6-diamine |
| SMILES | CNc1ccc([N+](=O)[O-])c(Nc2cc(F)c(Br)cc2F)n1 |
| InChI | InChI=1S/C12H9BrF2N4O2/c1-16-11-3-2-10(19(20)21)12(18-11)17-9-5-7(14)6(13)4-8(9)15/h2-5H,1H3,(H2,16,17,18) |
| InChIKey | NTYDCUQENCWXAU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|