C11H9BrFN5O2 — CID 107639593
N-(2-bromo-5-fluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine (PubChem CID 107639593) has the molecular formula C11H9BrFN5O2 and a molecular weight of 342.13 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine.
| Compound Name | N-(2-bromo-5-fluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 107639593 |
| Molecular Formula | C11H9BrFN5O2 |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine |
| SMILES | NNc1ccc([N+](=O)[O-])c(Nc2cc(F)ccc2Br)n1 |
| InChI | InChI=1S/C11H9BrFN5O2/c12-7-2-1-6(13)5-8(7)15-11-9(18(19)20)3-4-10(16-11)17-14/h1-5H,14H2,(H2,15,16,17) |
| InChIKey | FLZYMTFZMOVDQU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|