C11H9Cl2N5O2 — CID 80916589
N-(2,3-dichlorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine (PubChem CID 80916589) has the molecular formula C11H9Cl2N5O2 and a molecular weight of 314.13 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine.
| Compound Name | N-(2,3-dichlorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 80916589 |
| Molecular Formula | C11H9Cl2N5O2 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-6-hydrazinyl-3-nitropyridin-2-amine |
| SMILES | NNc1ccc([N+](=O)[O-])c(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C11H9Cl2N5O2/c12-6-2-1-3-7(10(6)13)15-11-8(18(19)20)4-5-9(16-11)17-14/h1-5H,14H2,(H2,15,16,17) |
| InChIKey | UIIXURLJQNLXFB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|