C13H13FN4O3 — CID 80785711
2-N-(4-fluoro-2-methoxyphenyl)-6-N-methyl-3-nitropyridine-2,6-diamine (PubChem CID 80785711) has the molecular formula C13H13FN4O3 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-N-(4-fluoro-2-methoxyphenyl)-6-N-methyl-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(4-fluoro-2-methoxyphenyl)-6-N-methyl-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 80785711 |
| Molecular Formula | C13H13FN4O3 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-N-(4-fluoro-2-methoxyphenyl)-6-N-methyl-3-nitropyridine-2,6-diamine |
| SMILES | CNc1ccc([N+](=O)[O-])c(Nc2ccc(F)cc2OC)n1 |
| InChI | InChI=1S/C13H13FN4O3/c1-15-12-6-5-10(18(19)20)13(17-12)16-9-4-3-8(14)7-11(9)21-2/h3-7H,1-2H3,(H2,15,16,17) |
| InChIKey | SDJCHNFKVAJAHR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|