C11H8BrFN4O2 — CID 104782017
2-N-(3-bromo-4-fluorophenyl)-3-nitropyridine-2,6-diamine (PubChem CID 104782017) has the molecular formula C11H8BrFN4O2 and a molecular weight of 327.11 g/mol. Its IUPAC name is 2-N-(3-bromo-4-fluorophenyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(3-bromo-4-fluorophenyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 104782017 |
| Molecular Formula | C11H8BrFN4O2 |
| Molecular Weight | 327.11 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 2-N-(3-bromo-4-fluorophenyl)-3-nitropyridine-2,6-diamine |
| SMILES | Nc1ccc([N+](=O)[O-])c(Nc2ccc(F)c(Br)c2)n1 |
| InChI | InChI=1S/C11H8BrFN4O2/c12-7-5-6(1-2-8(7)13)15-11-9(17(18)19)3-4-10(14)16-11/h1-5H,(H3,14,15,16) |
| InChIKey | UPBRWNOBTIAIGX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.11 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|