C17H13F3N2 — CID 141366646
6-methyl-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine (PubChem CID 141366646) has the molecular formula C17H13F3N2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 6-methyl-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine.
| Compound Name | 6-methyl-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 141366646 |
| Molecular Formula | C17H13F3N2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 6-methyl-N-[3-(trifluoromethyl)phenyl]isoquinolin-1-amine |
| SMILES | Cc1ccc2c(Nc3cccc(C(F)(F)F)c3)nccc2c1 |
| InChI | InChI=1S/C17H13F3N2/c1-11-5-6-15-12(9-11)7-8-21-16(15)22-14-4-2-3-13(10-14)17(18,19)20/h2-10H,1H3,(H,21,22) |
| InChIKey | LMFIGFSCMDPNJY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |