C13H5F3N6O4 — CID 21234441
4-nitro-N-[3-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-e][2,1,3]benzoxadiazol-5-amine (PubChem CID 21234441) has the molecular formula C13H5F3N6O4 and a molecular weight of 366.22 g/mol. Its IUPAC name is 4-nitro-N-[3-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-e][2,1,3]benzoxadiazol-5-amine.
| Compound Name | 4-nitro-N-[3-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-e][2,1,3]benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 21234441 |
| Molecular Formula | C13H5F3N6O4 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 4-nitro-N-[3-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-e][2,1,3]benzoxadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)c2nonc2c2nonc12 |
| InChI | InChI=1S/C13H5F3N6O4/c14-13(15,16)5-2-1-3-6(4-5)17-10-8-7(18-25-19-8)9-11(21-26-20-9)12(10)22(23)24/h1-4,17H |
| InChIKey | ISELOBSJEZUTPK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|