C13H8F4N4O — CID 144629370
5-N-[3-fluoro-5-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4,5-diamine (PubChem CID 144629370) has the molecular formula C13H8F4N4O and a molecular weight of 312.23 g/mol. Its IUPAC name is 5-N-[3-fluoro-5-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4,5-diamine.
| Compound Name | 5-N-[3-fluoro-5-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4,5-diamine |
|---|---|
| PubChem CID | 144629370 |
| Molecular Formula | C13H8F4N4O |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 5-N-[3-fluoro-5-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4,5-diamine |
| SMILES | Nc1c(Nc2cc(F)cc(C(F)(F)F)c2)ccc2nonc12 |
| InChI | InChI=1S/C13H8F4N4O/c14-7-3-6(13(15,16)17)4-8(5-7)19-9-1-2-10-12(11(9)18)21-22-20-10/h1-5,19H,18H2 |
| InChIKey | DOPYYHQNKBXTKB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|