C6H4FN3O — CID 130649170
5-fluoro-2,1,3-benzoxadiazol-4-amine (PubChem CID 130649170) has the molecular formula C6H4FN3O and a molecular weight of 153.12 g/mol. Its IUPAC name is 5-fluoro-2,1,3-benzoxadiazol-4-amine.
| Compound Name | 5-fluoro-2,1,3-benzoxadiazol-4-amine |
|---|---|
| PubChem CID | 130649170 |
| Molecular Formula | C6H4FN3O |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 5-fluoro-2,1,3-benzoxadiazol-4-amine |
| SMILES | Nc1c(F)ccc2nonc12 |
| InChI | InChI=1S/C6H4FN3O/c7-3-1-2-4-6(5(3)8)10-11-9-4/h1-2H,8H2 |
| InChIKey | WRBRJPSCNPKILI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|