C12H7F2N3OS — CID 43518925
4-(2,5-difluorophenyl)sulfanyl-2,1,3-benzoxadiazol-7-amine (PubChem CID 43518925) has the molecular formula C12H7F2N3OS and a molecular weight of 279.27 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)sulfanyl-2,1,3-benzoxadiazol-7-amine.
| Compound Name | 4-(2,5-difluorophenyl)sulfanyl-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 43518925 |
| Molecular Formula | C12H7F2N3OS |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 4-(2,5-difluorophenyl)sulfanyl-2,1,3-benzoxadiazol-7-amine |
| SMILES | Nc1ccc(Sc2cc(F)ccc2F)c2nonc12 |
| InChI | InChI=1S/C12H7F2N3OS/c13-6-1-2-7(14)10(5-6)19-9-4-3-8(15)11-12(9)17-18-16-11/h1-5H,15H2 |
| InChIKey | MTCOJTAFQLDSTM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|