C10H7F2N3S — CID 116798209
2-(2,5-difluorophenyl)sulfanylpyrimidin-4-amine (PubChem CID 116798209) has the molecular formula C10H7F2N3S and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfanylpyrimidin-4-amine.
| Compound Name | 2-(2,5-difluorophenyl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116798209 |
| Molecular Formula | C10H7F2N3S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfanylpyrimidin-4-amine |
| SMILES | Nc1ccnc(Sc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C10H7F2N3S/c11-6-1-2-7(12)8(5-6)16-10-14-4-3-9(13)15-10/h1-5H,(H2,13,14,15) |
| InChIKey | JGWMOXKOSCBDIN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |