C12H6F4S2 — CID 22351785
2-[(2,5-difluorophenyl)disulfanyl]-1,4-difluorobenzene (PubChem CID 22351785) has the molecular formula C12H6F4S2 and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)disulfanyl]-1,4-difluorobenzene.
| Compound Name | 2-[(2,5-difluorophenyl)disulfanyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 22351785 |
| Molecular Formula | C12H6F4S2 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 2-[(2,5-difluorophenyl)disulfanyl]-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(SSc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C12H6F4S2/c13-7-1-3-9(15)11(5-7)17-18-12-6-8(14)2-4-10(12)16/h1-6H |
| InChIKey | QFBSAAGMHNOCOB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|