C13H8Cl3F3N2 — CID 116698705
4,5-dichloro-2-N-[3-chloro-5-(trifluoromethyl)phenyl]benzene-1,2-diamine (PubChem CID 116698705) has the molecular formula C13H8Cl3F3N2 and a molecular weight of 355.57 g/mol. Its IUPAC name is 4,5-dichloro-2-N-[3-chloro-5-(trifluoromethyl)phenyl]benzene-1,2-diamine.
| Compound Name | 4,5-dichloro-2-N-[3-chloro-5-(trifluoromethyl)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 116698705 |
| Molecular Formula | C13H8Cl3F3N2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 4,5-dichloro-2-N-[3-chloro-5-(trifluoromethyl)phenyl]benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(Cl)cc1Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8Cl3F3N2/c14-7-1-6(13(17,18)19)2-8(3-7)21-12-5-10(16)9(15)4-11(12)20/h1-5,21H,20H2 |
| InChIKey | SGHLECIDYQTBGF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|