C13H8FN3O3 — CID 158803345
5-[(3-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazole (PubChem CID 158803345) has the molecular formula C13H8FN3O3 and a molecular weight of 273.22 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazole.
| Compound Name | 5-[(3-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 158803345 |
| Molecular Formula | C13H8FN3O3 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 5-[(3-fluorophenyl)methyl]-4-nitro-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1c(Cc2cccc(F)c2)ccc2nonc12 |
| InChI | InChI=1S/C13H8FN3O3/c14-10-3-1-2-8(7-10)6-9-4-5-11-12(16-20-15-11)13(9)17(18)19/h1-5,7H,6H2 |
| InChIKey | ITTNTTJBXXWWFO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|