C18H14N10O6 — CID 137089213
2-[(E)-[[6-[2-(4-methylphenyl)hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-4,6-dinitrophenol (PubChem CID 137089213) has the molecular formula C18H14N10O6 and a molecular weight of 466.37 g/mol. Its IUPAC name is 2-[(E)-[[6-[2-(4-methylphenyl)hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-4,6-dinitrophenol.
| Compound Name | 2-[(E)-[[6-[2-(4-methylphenyl)hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 137089213 |
| Molecular Formula | C18H14N10O6 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2-[(E)-[[6-[2-(4-methylphenyl)hydrazinyl]-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
| SMILES | Cc1ccc(NNc2nc3nonc3nc2N/N=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C18H14N10O6/c1-9-2-4-11(5-3-9)22-24-16-15(20-17-18(21-16)26-34-25-17)23-19-8-10-6-12(27(30)31)7-13(14(10)29)28(32)33/h2-8,22,29H,1H3,(H,20,23,25)(H,21,24,26)/b19-8+ |
| InChIKey | KIVGJEFOOCWTDM-UFWORHAWSA-N |
| XLogP | 2.73 |
| TPSA | 219.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|