C21H11F5N4O — CID 135536519
2-[4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]quinazolin-2-yl]phenol (PubChem CID 135536519) has the molecular formula C21H11F5N4O and a molecular weight of 430.34 g/mol. Its IUPAC name is 2-[4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]quinazolin-2-yl]phenol.
| Compound Name | 2-[4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]quinazolin-2-yl]phenol |
|---|---|
| PubChem CID | 135536519 |
| Molecular Formula | C21H11F5N4O |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-[4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]quinazolin-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(N/N=C/c2c(F)c(F)c(F)c(F)c2F)c2ccccc2n1 |
| InChI | InChI=1S/C21H11F5N4O/c22-15-12(16(23)18(25)19(26)17(15)24)9-27-30-21-10-5-1-3-7-13(10)28-20(29-21)11-6-2-4-8-14(11)31/h1-9,31H,(H,28,29,30)/b27-9+ |
| InChIKey | NZJBGEBULXMVSU-OXUBWTJQSA-N |
| XLogP | 5.14 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|