C22H24Cl2N6 — CID 173480564
N'-[4-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]butyl]-3-(methylamino)prop-2-enimidamide (PubChem CID 173480564) has the molecular formula C22H24Cl2N6 and a molecular weight of 443.38 g/mol. Its IUPAC name is N'-[4-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]butyl]-3-(methylamino)prop-2-enimidamide.
| Compound Name | N'-[4-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]butyl]-3-(methylamino)prop-2-enimidamide |
|---|---|
| PubChem CID | 173480564 |
| Molecular Formula | C22H24Cl2N6 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N'-[4-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]butyl]-3-(methylamino)prop-2-enimidamide |
| SMILES | CNC=C/C(N)=N\CCCCNc1nc(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C22H24Cl2N6/c1-26-13-10-20(25)27-11-4-5-12-28-21-17-6-2-3-7-19(17)29-22(30-21)16-9-8-15(23)14-18(16)24/h2-3,6-10,13-14,26H,4-5,11-12H2,1H3,(H2,25,27)(H,28,29,30) |
| InChIKey | GDEHKAZIWKZIEV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|