C35H36FN7O2 — CID 143665379
4-N-[2-(3-fluoro-4-phenylphenyl)-7-methoxy-6-[2-(4-methylpiperazin-1-yl)ethoxy]quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine (PubChem CID 143665379) has the molecular formula C35H36FN7O2 and a molecular weight of 605.72 g/mol. Its IUPAC name is 4-N-[2-(3-fluoro-4-phenylphenyl)-7-methoxy-6-[2-(4-methylpiperazin-1-yl)ethoxy]quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine.
| Compound Name | 4-N-[2-(3-fluoro-4-phenylphenyl)-7-methoxy-6-[2-(4-methylpiperazin-1-yl)ethoxy]quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143665379 |
| Molecular Formula | C35H36FN7O2 |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | 4-N-[2-(3-fluoro-4-phenylphenyl)-7-methoxy-6-[2-(4-methylpiperazin-1-yl)ethoxy]quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2nc(-c3ccc(-c4ccccc4)c(F)c3)nc3cc(OC)c(OCCN4CCN(C)CC4)cc23)ccc1N |
| InChI | InChI=1S/C35H36FN7O2/c1-42-12-14-43(15-13-42)16-17-45-33-20-28-31(21-32(33)44-2)40-34(41-35(28)39-26-9-11-30(38)25(18-26)22-37)24-8-10-27(29(36)19-24)23-6-4-3-5-7-23/h3-11,18-22,37H,12-17,38H2,1-2H3,(H,39,40,41)/b37-22+ |
| InChIKey | WMNNCRDENMVOOG-SEBMTOOBSA-N |
| XLogP | 6.06 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|