C17H18N6O2S — CID 144695783
ethyl 3-[7-(4-amino-3-methanimidoylanilino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]propanoate (PubChem CID 144695783) has the molecular formula C17H18N6O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is ethyl 3-[7-(4-amino-3-methanimidoylanilino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]propanoate.
| Compound Name | ethyl 3-[7-(4-amino-3-methanimidoylanilino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]propanoate |
|---|---|
| PubChem CID | 144695783 |
| Molecular Formula | C17H18N6O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl 3-[7-(4-amino-3-methanimidoylanilino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]propanoate |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc(CCC(=O)OCC)nc23)ccc1N |
| InChI | InChI=1S/C17H18N6O2S/c1-2-25-14(24)6-5-13-23-15-16(20-9-21-17(15)26-13)22-11-3-4-12(19)10(7-11)8-18/h3-4,7-9,18H,2,5-6,19H2,1H3,(H,20,21,22)/b18-8+ |
| InChIKey | ZMUBLMZVXUXXLL-QGMBQPNBSA-N |
| XLogP | 2.91 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|