C14H11BrN6O — CID 144595038
4-(4-amino-3-methanimidoylanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 144595038) has the molecular formula C14H11BrN6O and a molecular weight of 359.19 g/mol. Its IUPAC name is 4-(4-amino-3-methanimidoylanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 4-(4-amino-3-methanimidoylanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 144595038 |
| Molecular Formula | C14H11BrN6O |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-(4-amino-3-methanimidoylanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3[nH]c(C=O)c(Br)c23)ccc1N |
| InChI | InChI=1S/C14H11BrN6O/c15-12-10(5-22)21-14-11(12)13(18-6-19-14)20-8-1-2-9(17)7(3-8)4-16/h1-6,16H,17H2,(H2,18,19,20,21)/b16-4+ |
| InChIKey | OVRGJTSQEYKKQN-AYSLTRBKSA-N |
| XLogP | 2.86 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|