C19H20BrN7O3 — CID 144594941
[4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone (PubChem CID 144594941) has the molecular formula C19H20BrN7O3 and a molecular weight of 474.32 g/mol. Its IUPAC name is [4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 144594941 |
| Molecular Formula | C19H20BrN7O3 |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5-bromo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3[nH]c(C(=O)N4CCOCC4)c(Br)c23)c(OC)cc1N |
| InChI | InChI=1S/C19H20BrN7O3/c1-29-13-7-11(22)10(8-21)6-12(13)25-17-14-15(20)16(26-18(14)24-9-23-17)19(28)27-2-4-30-5-3-27/h6-9,21H,2-5,22H2,1H3,(H2,23,24,25,26)/b21-8+ |
| InChIKey | SPVWQIMDZQLUPM-ODCIPOBUSA-N |
| XLogP | 2.52 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|