C17H20N6O — CID 144594944
4-N-(6-ethyl-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-methanimidoyl-5-methoxybenzene-1,4-diamine (PubChem CID 144594944) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 4-N-(6-ethyl-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-methanimidoyl-5-methoxybenzene-1,4-diamine.
| Compound Name | 4-N-(6-ethyl-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-methanimidoyl-5-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 144594944 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-N-(6-ethyl-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2-methanimidoyl-5-methoxybenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3[nH]c(CC)c(C)c23)c(OC)cc1N |
| InChI | InChI=1S/C17H20N6O/c1-4-12-9(2)15-16(22-12)20-8-21-17(15)23-13-5-10(7-18)11(19)6-14(13)24-3/h5-8,18H,4,19H2,1-3H3,(H2,20,21,22,23)/b18-7+ |
| InChIKey | KZGKQDIFLKRWPX-CNHKJKLMSA-N |
| XLogP | 3.16 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|