C20H26N6 — CID 144595032
2-methanimidoyl-4-N-[6-(2-methylpropyl)-5-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 144595032) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-methanimidoyl-4-N-[6-(2-methylpropyl)-5-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-4-N-[6-(2-methylpropyl)-5-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 144595032 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-methanimidoyl-4-N-[6-(2-methylpropyl)-5-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3[nH]c(CC(C)C)c(C(C)C)c23)ccc1N |
| InChI | InChI=1S/C20H26N6/c1-11(2)7-16-17(12(3)4)18-19(23-10-24-20(18)26-16)25-14-5-6-15(22)13(8-14)9-21/h5-6,8-12,21H,7,22H2,1-4H3,(H2,23,24,25,26)/b21-9+ |
| InChIKey | VBLJQPKBIDLWTI-ZVBGSRNCSA-N |
| XLogP | 4.60 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|