C17H18N4O2 — CID 143498795
2-methanimidoyl-4-N-[5-(4-methoxycyclohexa-2,4-dien-1-yl)-1,3-oxazol-2-yl]benzene-1,4-diamine (PubChem CID 143498795) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-methanimidoyl-4-N-[5-(4-methoxycyclohexa-2,4-dien-1-yl)-1,3-oxazol-2-yl]benzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-4-N-[5-(4-methoxycyclohexa-2,4-dien-1-yl)-1,3-oxazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143498795 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-methanimidoyl-4-N-[5-(4-methoxycyclohexa-2,4-dien-1-yl)-1,3-oxazol-2-yl]benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ncc(C3C=CC(OC)=CC3)o2)ccc1N |
| InChI | InChI=1S/C17H18N4O2/c1-22-14-5-2-11(3-6-14)16-10-20-17(23-16)21-13-4-7-15(19)12(8-13)9-18/h2,4-11,18H,3,19H2,1H3,(H,20,21)/b18-9+ |
| InChIKey | VMGNRWPKKSHYAC-GIJQJNRQSA-N |
| XLogP | 3.57 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|