C25H28N10O3 — CID 142056786
4-N-[2-[2-(4-amino-3-methanimidoylanilino)hydrazinyl]phenyl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 142056786) has the molecular formula C25H28N10O3 and a molecular weight of 516.57 g/mol. Its IUPAC name is 4-N-[2-[2-(4-amino-3-methanimidoylanilino)hydrazinyl]phenyl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(4-amino-3-methanimidoylanilino)hydrazinyl]phenyl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142056786 |
| Molecular Formula | C25H28N10O3 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 4-N-[2-[2-(4-amino-3-methanimidoylanilino)hydrazinyl]phenyl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | [H]/N=C/c1cc(NNNc2ccccc2Nc2ncnc(Nc3cc(OC)c(OC)c(OC)c3)n2)ccc1N |
| InChI | InChI=1S/C25H28N10O3/c1-36-21-11-17(12-22(37-2)23(21)38-3)30-24-28-14-29-25(32-24)31-19-6-4-5-7-20(19)34-35-33-16-8-9-18(27)15(10-16)13-26/h4-14,26,33-35H,27H2,1-3H3,(H2,28,29,30,31,32)/b26-13+ |
| InChIKey | PXQYCUOMHPRJHW-LGJNPRDNSA-N |
| XLogP | 3.91 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|