C21H23N5O3 — CID 23536734
2-N-(2,3-dihydro-1H-inden-1-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23536734) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-N-(2,3-dihydro-1H-inden-1-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,3-dihydro-1H-inden-1-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23536734 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-N-(2,3-dihydro-1H-inden-1-yl)-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(Nc2ncnc(NC3CCc4ccccc43)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N5O3/c1-27-17-10-14(11-18(28-2)19(17)29-3)24-20-22-12-23-21(26-20)25-16-9-8-13-6-4-5-7-15(13)16/h4-7,10-12,16H,8-9H2,1-3H3,(H2,22,23,24,25,26) |
| InChIKey | UHSMYGXVVFAZMB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |