C18H23N5O — CID 123868395
(1S,2S,4R)-4-[[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-1,3,5-triazin-2-yl]amino]-2-methylcyclopentan-1-ol (PubChem CID 123868395) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is (1S,2S,4R)-4-[[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-1,3,5-triazin-2-yl]amino]-2-methylcyclopentan-1-ol.
| Compound Name | (1S,2S,4R)-4-[[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-1,3,5-triazin-2-yl]amino]-2-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 123868395 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (1S,2S,4R)-4-[[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-1,3,5-triazin-2-yl]amino]-2-methylcyclopentan-1-ol |
| SMILES | C[C@H]1C[C@@H](Nc2ncnc(N[C@H]3CCc4ccccc43)n2)C[C@@H]1O |
| InChI | InChI=1S/C18H23N5O/c1-11-8-13(9-16(11)24)21-17-19-10-20-18(23-17)22-15-7-6-12-4-2-3-5-14(12)15/h2-5,10-11,13,15-16,24H,6-9H2,1H3,(H2,19,20,21,22,23)/t11-,13+,15-,16-/m0/s1 |
| InChIKey | BOHDRUAQIXDRMX-YOENINGUSA-N |
| XLogP | 2.54 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |