C19H26N6O3S — CID 87450961
[(1R,3R)-3-[[4-(2,3-dihydro-1H-inden-1-ylamino)-6-methyl-1,3,5-triazin-2-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 87450961) has the molecular formula C19H26N6O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is [(1R,3R)-3-[[4-(2,3-dihydro-1H-inden-1-ylamino)-6-methyl-1,3,5-triazin-2-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,3R)-3-[[4-(2,3-dihydro-1H-inden-1-ylamino)-6-methyl-1,3,5-triazin-2-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 87450961 |
| Molecular Formula | C19H26N6O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [(1R,3R)-3-[[4-(2,3-dihydro-1H-inden-1-ylamino)-6-methyl-1,3,5-triazin-2-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | Cc1nc(NC2CCc3ccccc32)nc(N[C@@H]2CC[C@@H](COS(N)(=O)=O)C2)n1 |
| InChI | InChI=1S/C19H26N6O3S/c1-12-21-18(23-15-8-6-13(10-15)11-28-29(20,26)27)25-19(22-12)24-17-9-7-14-4-2-3-5-16(14)17/h2-5,13,15,17H,6-11H2,1H3,(H2,20,26,27)(H2,21,22,23,24,25)/t13-,15-,17?/m1/s1 |
| InChIKey | UNJXOSVMMHXPQT-KQSHLBLPSA-N |
| XLogP | 2.08 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |