C15H19N5S2 — CID 159175397
CID 159175397 (PubChem CID 159175397) has the molecular formula C15H19N5S2 and a molecular weight of 333.49 g/mol.
| Compound Name | CID 159175397 |
|---|---|
| PubChem CID | 159175397 |
| Molecular Formula | C15H19N5S2 |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | — |
| SMILES | Cc1nc(N)nc(N[C@H]2c3ccccc3CC[C@@H]2C)n1.S=S |
| InChI | InChI=1S/C15H19N5.S2/c1-9-7-8-11-5-3-4-6-12(11)13(9)19-15-18-10(2)17-14(16)20-15;1-2/h3-6,9,13H,7-8H2,1-2H3,(H3,16,17,18,19,20);/t9-,13+;/m0./s1 |
| InChIKey | KMFCQJMPUGSTMV-BTJVGWIPSA-N |
| XLogP | 2.49 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |