C13H15N5S — CID 143929032
3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2,3-dihydro-1H-indene-5-thiol (PubChem CID 143929032) has the molecular formula C13H15N5S and a molecular weight of 273.37 g/mol. Its IUPAC name is 3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2,3-dihydro-1H-indene-5-thiol.
| Compound Name | 3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2,3-dihydro-1H-indene-5-thiol |
|---|---|
| PubChem CID | 143929032 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2,3-dihydro-1H-indene-5-thiol |
| SMILES | Cc1nc(N)nc(NC2CCc3ccc(S)cc32)n1 |
| InChI | InChI=1S/C13H15N5S/c1-7-15-12(14)18-13(16-7)17-11-5-3-8-2-4-9(19)6-10(8)11/h2,4,6,11,19H,3,5H2,1H3,(H3,14,15,16,17,18) |
| InChIKey | OSMOUHRGQSGCTK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|