C29H43N5O6S — CID 158908853
[(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-[2-(2-propoxyethoxy)ethoxy]cyclopentyl]methyl sulfamate;methane (PubChem CID 158908853) has the molecular formula C29H43N5O6S and a molecular weight of 589.76 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-[2-(2-propoxyethoxy)ethoxy]cyclopentyl]methyl sulfamate;methane.
| Compound Name | [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-[2-(2-propoxyethoxy)ethoxy]cyclopentyl]methyl sulfamate;methane |
|---|---|
| PubChem CID | 158908853 |
| Molecular Formula | C29H43N5O6S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-2-[2-(2-propoxyethoxy)ethoxy]cyclopentyl]methyl sulfamate;methane |
| SMILES | C.CCCOCCOCCO[C@H]1C[C@H](n2ccc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@H]1COS(N)(=O)=O |
| InChI | InChI=1S/C28H39N5O6S.CH4/c1-2-11-36-12-13-37-14-15-38-26-17-22(16-21(26)18-39-40(29,34)35)33-10-9-24-27(30-19-31-28(24)33)32-25-8-7-20-5-3-4-6-23(20)25;/h3-6,9-10,19,21-22,25-26H,2,7-8,11-18H2,1H3,(H2,29,34,35)(H,30,31,32);1H4/t21-,22+,25-,26-;/m0./s1 |
| InChIKey | JGJRYOMCJSRMOP-RYNSBEJASA-N |
| XLogP | 4.17 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|