C30H42N4O4SSi — CID 87076704
(E)-1-[(1S,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]but-1-ene-2-sulfonic acid (PubChem CID 87076704) has the molecular formula C30H42N4O4SSi and a molecular weight of 582.84 g/mol. Its IUPAC name is (E)-1-[(1S,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]but-1-ene-2-sulfonic acid.
| Compound Name | (E)-1-[(1S,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]but-1-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 87076704 |
| Molecular Formula | C30H42N4O4SSi |
| Molecular Weight | 582.84 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | (E)-1-[(1S,2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]but-1-ene-2-sulfonic acid |
| SMILES | CC/C(=C\[C@@H]1C[C@@H](n2ccc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@@H]1O[Si](C)(C)C(C)(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C30H42N4O4SSi/c1-7-23(39(35,36)37)17-21-16-22(18-27(21)38-40(5,6)30(2,3)4)34-15-14-25-28(31-19-32-29(25)34)33-26-13-12-20-10-8-9-11-24(20)26/h8-11,14-15,17,19,21-22,26-27H,7,12-13,16,18H2,1-6H3,(H,31,32,33)(H,35,36,37)/b23-17+/t21-,22+,26-,27-/m0/s1 |
| InChIKey | QGKDFNCJMXCRSP-VAZYBRQQSA-N |
| XLogP | 7.05 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.84 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|