C41H50N4O2Si — CID 134944488
7-[(1R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxy]cyclopentyl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 134944488) has the molecular formula C41H50N4O2Si and a molecular weight of 658.96 g/mol. Its IUPAC name is 7-[(1R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxy]cyclopentyl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(1R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxy]cyclopentyl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134944488 |
| Molecular Formula | C41H50N4O2Si |
| Molecular Weight | 658.96 g/mol |
| Exact Mass | 658.37 |
| IUPAC Name | 7-[(1R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2-methylpropan-2-yl)oxy]cyclopentyl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)O[C@H]1C[C@H](n2ccc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H50N4O2Si/c1-40(2,3)47-37-26-31(45-24-23-35-38(42-28-43-39(35)45)44-36-22-21-29-15-13-14-20-34(29)36)25-30(37)27-46-48(41(4,5)6,32-16-9-7-10-17-32)33-18-11-8-12-19-33/h7-20,23-24,28,30-31,36-37H,21-22,25-27H2,1-6H3,(H,42,43,44)/t30-,31+,36-,37-/m0/s1 |
| InChIKey | SCQVHWSNTUDUBG-CQMORRCISA-N |
| XLogP | 8.24 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.96 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|