C21H21N5O3 — CID 89344364
[4-[2-(4-amino-3-methanimidoylanilino)-1,3-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 89344364) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is [4-[2-(4-amino-3-methanimidoylanilino)-1,3-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-(4-amino-3-methanimidoylanilino)-1,3-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 89344364 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [4-[2-(4-amino-3-methanimidoylanilino)-1,3-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | [H]/N=C/c1cc(Nc2ncc(-c3ccc(C(=O)N4CCOCC4)cc3)o2)ccc1N |
| InChI | InChI=1S/C21H21N5O3/c22-12-16-11-17(5-6-18(16)23)25-21-24-13-19(29-21)14-1-3-15(4-2-14)20(27)26-7-9-28-10-8-26/h1-6,11-13,22H,7-10,23H2,(H,24,25)/b22-12+ |
| InChIKey | TWARMMDDFVYZAR-WSDLNYQXSA-N |
| XLogP | 3.14 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|