C19H22N4O3 — CID 1223934
3-(1,5-dimethylpyrazol-4-yl)-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide (PubChem CID 1223934) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-4-yl)-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 3-(1,5-dimethylpyrazol-4-yl)-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1223934 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-(1,5-dimethylpyrazol-4-yl)-N-[4-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
| SMILES | Cc1c(C=CC(=O)Nc2ccc(C(=O)N3CCOCC3)cc2)cnn1C |
| InChI | InChI=1S/C19H22N4O3/c1-14-16(13-20-22(14)2)5-8-18(24)21-17-6-3-15(4-7-17)19(25)23-9-11-26-12-10-23/h3-8,13H,9-12H2,1-2H3,(H,21,24) |
| InChIKey | FCZZARHBWXZVIS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|