C15H16N2O5 — CID 17205425
(E)-4-[3-(morpholine-4-carbonyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 17205425) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (E)-4-[3-(morpholine-4-carbonyl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-(morpholine-4-carbonyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 17205425 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (E)-4-[3-(morpholine-4-carbonyl)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H16N2O5/c18-13(4-5-14(19)20)16-12-3-1-2-11(10-12)15(21)17-6-8-22-9-7-17/h1-5,10H,6-9H2,(H,16,18)(H,19,20)/b5-4+ |
| InChIKey | UXMBMTDEWHQONJ-SNAWJCMRSA-N |
| XLogP | 0.74 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|