C18H28N4O2 — CID 143847601
ethyl 2-[[1-(4-amino-3-methanimidoylanilino)cyclohexyl]methylamino]acetate (PubChem CID 143847601) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is ethyl 2-[[1-(4-amino-3-methanimidoylanilino)cyclohexyl]methylamino]acetate.
| Compound Name | ethyl 2-[[1-(4-amino-3-methanimidoylanilino)cyclohexyl]methylamino]acetate |
|---|---|
| PubChem CID | 143847601 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | ethyl 2-[[1-(4-amino-3-methanimidoylanilino)cyclohexyl]methylamino]acetate |
| SMILES | [H]/N=C/c1cc(NC2(CNCC(=O)OCC)CCCCC2)ccc1N |
| InChI | InChI=1S/C18H28N4O2/c1-2-24-17(23)12-21-13-18(8-4-3-5-9-18)22-15-6-7-16(20)14(10-15)11-19/h6-7,10-11,19,21-22H,2-5,8-9,12-13,20H2,1H3/b19-11+ |
| InChIKey | VENACNOEVSCKQK-YBFXNURJSA-N |
| XLogP | 2.53 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|