C13H23Cl2N5O2 — CID 121396239
5-methyl-4,6-dimorpholin-4-ylpyrimidin-2-amine;dihydrochloride (PubChem CID 121396239) has the molecular formula C13H23Cl2N5O2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 5-methyl-4,6-dimorpholin-4-ylpyrimidin-2-amine;dihydrochloride.
| Compound Name | 5-methyl-4,6-dimorpholin-4-ylpyrimidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 121396239 |
| Molecular Formula | C13H23Cl2N5O2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-methyl-4,6-dimorpholin-4-ylpyrimidin-2-amine;dihydrochloride |
| SMILES | Cc1c(N2CCOCC2)nc(N)nc1N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C13H21N5O2.2ClH/c1-10-11(17-2-6-19-7-3-17)15-13(14)16-12(10)18-4-8-20-9-5-18;;/h2-9H2,1H3,(H2,14,15,16);2*1H |
| InChIKey | OADFKLSGWGFOHM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |