C13H24N4O3S — CID 102826141
1-(3-methylbutyl)-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine (PubChem CID 102826141) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-(3-methylbutyl)-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine.
| Compound Name | 1-(3-methylbutyl)-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 102826141 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-(3-methylbutyl)-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine |
| SMILES | CC(C)CCn1nc(N2CCOCC2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C13H24N4O3S/c1-10(2)4-5-17-12(14)11(21(3,18)19)13(15-17)16-6-8-20-9-7-16/h10H,4-9,14H2,1-3H3 |
| InChIKey | CGYIZIMAYUCBJS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |