C11H20N4O3S — CID 102825419
2-[5-amino-3-(1-cyclopropylethylamino)-4-methylsulfonylpyrazol-1-yl]ethanol (PubChem CID 102825419) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[5-amino-3-(1-cyclopropylethylamino)-4-methylsulfonylpyrazol-1-yl]ethanol.
| Compound Name | 2-[5-amino-3-(1-cyclopropylethylamino)-4-methylsulfonylpyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 102825419 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[5-amino-3-(1-cyclopropylethylamino)-4-methylsulfonylpyrazol-1-yl]ethanol |
| SMILES | CC(Nc1nn(CCO)c(N)c1S(C)(=O)=O)C1CC1 |
| InChI | InChI=1S/C11H20N4O3S/c1-7(8-3-4-8)13-11-9(19(2,17)18)10(12)15(14-11)5-6-16/h7-8,16H,3-6,12H2,1-2H3,(H,13,14) |
| InChIKey | KKUQGBKKJRDEJB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |