C10H19N5O3S — CID 102825417
2-[5-amino-4-methylsulfonyl-3-(pyrrolidin-3-ylamino)pyrazol-1-yl]ethanol (PubChem CID 102825417) has the molecular formula C10H19N5O3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-[5-amino-4-methylsulfonyl-3-(pyrrolidin-3-ylamino)pyrazol-1-yl]ethanol.
| Compound Name | 2-[5-amino-4-methylsulfonyl-3-(pyrrolidin-3-ylamino)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 102825417 |
| Molecular Formula | C10H19N5O3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[5-amino-4-methylsulfonyl-3-(pyrrolidin-3-ylamino)pyrazol-1-yl]ethanol |
| SMILES | CS(=O)(=O)c1c(NC2CCNC2)nn(CCO)c1N |
| InChI | InChI=1S/C10H19N5O3S/c1-19(17,18)8-9(11)15(4-5-16)14-10(8)13-7-2-3-12-6-7/h7,12,16H,2-6,11H2,1H3,(H,13,14) |
| InChIKey | GDEAKMDLIVSWLB-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |