C14H24N4O2 — CID 102808792
methyl 5-amino-1-butyl-3-(1-cyclopropylethylamino)pyrazole-4-carboxylate (PubChem CID 102808792) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl 5-amino-1-butyl-3-(1-cyclopropylethylamino)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-butyl-3-(1-cyclopropylethylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808792 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | methyl 5-amino-1-butyl-3-(1-cyclopropylethylamino)pyrazole-4-carboxylate |
| SMILES | CCCCn1nc(NC(C)C2CC2)c(C(=O)OC)c1N |
| InChI | InChI=1S/C14H24N4O2/c1-4-5-8-18-12(15)11(14(19)20-3)13(17-18)16-9(2)10-6-7-10/h9-10H,4-8,15H2,1-3H3,(H,16,17) |
| InChIKey | HIRGVAKLSAZIIK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |