C14H24N4O3 — CID 102808783
methyl 5-amino-1-butyl-3-(oxan-4-ylamino)pyrazole-4-carboxylate (PubChem CID 102808783) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 5-amino-1-butyl-3-(oxan-4-ylamino)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-butyl-3-(oxan-4-ylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808783 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | methyl 5-amino-1-butyl-3-(oxan-4-ylamino)pyrazole-4-carboxylate |
| SMILES | CCCCn1nc(NC2CCOCC2)c(C(=O)OC)c1N |
| InChI | InChI=1S/C14H24N4O3/c1-3-4-7-18-12(15)11(14(19)20-2)13(17-18)16-10-5-8-21-9-6-10/h10H,3-9,15H2,1-2H3,(H,16,17) |
| InChIKey | RBRCRGWOGNRYKN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |