C15H18N4O2 — CID 102808304
methyl 5-amino-3-(cyclopropylamino)-1-(2-methylphenyl)pyrazole-4-carboxylate (PubChem CID 102808304) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 5-amino-3-(cyclopropylamino)-1-(2-methylphenyl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-(cyclopropylamino)-1-(2-methylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808304 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methyl 5-amino-3-(cyclopropylamino)-1-(2-methylphenyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(NC2CC2)nn(-c2ccccc2C)c1N |
| InChI | InChI=1S/C15H18N4O2/c1-9-5-3-4-6-11(9)19-13(16)12(15(20)21-2)14(18-19)17-10-7-8-10/h3-6,10H,7-8,16H2,1-2H3,(H,17,18) |
| InChIKey | XBILINQCBXVHOQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |