C12H13BrN4O2 — CID 102808592
methyl 5-amino-1-(2-bromophenyl)-3-(methylamino)pyrazole-4-carboxylate (PubChem CID 102808592) has the molecular formula C12H13BrN4O2 and a molecular weight of 325.17 g/mol. Its IUPAC name is methyl 5-amino-1-(2-bromophenyl)-3-(methylamino)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(2-bromophenyl)-3-(methylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808592 |
| Molecular Formula | C12H13BrN4O2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | methyl 5-amino-1-(2-bromophenyl)-3-(methylamino)pyrazole-4-carboxylate |
| SMILES | CNc1nn(-c2ccccc2Br)c(N)c1C(=O)OC |
| InChI | InChI=1S/C12H13BrN4O2/c1-15-11-9(12(18)19-2)10(14)17(16-11)8-6-4-3-5-7(8)13/h3-6H,14H2,1-2H3,(H,15,16) |
| InChIKey | QVFQYINUXIJBQZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |