C12H12ClFN4O2 — CID 102809174
methyl 5-amino-1-(4-chloro-3-fluorophenyl)-3-(methylamino)pyrazole-4-carboxylate (PubChem CID 102809174) has the molecular formula C12H12ClFN4O2 and a molecular weight of 298.71 g/mol. Its IUPAC name is methyl 5-amino-1-(4-chloro-3-fluorophenyl)-3-(methylamino)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(4-chloro-3-fluorophenyl)-3-(methylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102809174 |
| Molecular Formula | C12H12ClFN4O2 |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | methyl 5-amino-1-(4-chloro-3-fluorophenyl)-3-(methylamino)pyrazole-4-carboxylate |
| SMILES | CNc1nn(-c2ccc(Cl)c(F)c2)c(N)c1C(=O)OC |
| InChI | InChI=1S/C12H12ClFN4O2/c1-16-11-9(12(19)20-2)10(15)18(17-11)6-3-4-7(13)8(14)5-6/h3-5H,15H2,1-2H3,(H,16,17) |
| InChIKey | YPDYQTRSOWZCCT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |