C13H15FN4O2 — CID 102808930
methyl 5-amino-3-(ethylamino)-1-(3-fluorophenyl)pyrazole-4-carboxylate (PubChem CID 102808930) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is methyl 5-amino-3-(ethylamino)-1-(3-fluorophenyl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-(ethylamino)-1-(3-fluorophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808930 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl 5-amino-3-(ethylamino)-1-(3-fluorophenyl)pyrazole-4-carboxylate |
| SMILES | CCNc1nn(-c2cccc(F)c2)c(N)c1C(=O)OC |
| InChI | InChI=1S/C13H15FN4O2/c1-3-16-12-10(13(19)20-2)11(15)18(17-12)9-6-4-5-8(14)7-9/h4-7H,3,15H2,1-2H3,(H,16,17) |
| InChIKey | PIBLHKYABSKXTR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |