C14H17FN4O2 — CID 102809042
methyl 5-amino-3-(ethylamino)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxylate (PubChem CID 102809042) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is methyl 5-amino-3-(ethylamino)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-(ethylamino)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102809042 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | methyl 5-amino-3-(ethylamino)-1-[(4-fluorophenyl)methyl]pyrazole-4-carboxylate |
| SMILES | CCNc1nn(Cc2ccc(F)cc2)c(N)c1C(=O)OC |
| InChI | InChI=1S/C14H17FN4O2/c1-3-17-13-11(14(20)21-2)12(16)19(18-13)8-9-4-6-10(15)7-5-9/h4-7H,3,8,16H2,1-2H3,(H,17,18) |
| InChIKey | HQLLQJVKQNFDMI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |