C12H15N7O2 — CID 102809208
methyl 5-amino-3-(azetidin-3-ylamino)-1-pyrazin-2-ylpyrazole-4-carboxylate (PubChem CID 102809208) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is methyl 5-amino-3-(azetidin-3-ylamino)-1-pyrazin-2-ylpyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-(azetidin-3-ylamino)-1-pyrazin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102809208 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 5-amino-3-(azetidin-3-ylamino)-1-pyrazin-2-ylpyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(NC2CNC2)nn(-c2cnccn2)c1N |
| InChI | InChI=1S/C12H15N7O2/c1-21-12(20)9-10(13)19(8-6-14-2-3-16-8)18-11(9)17-7-4-15-5-7/h2-3,6-7,15H,4-5,13H2,1H3,(H,17,18) |
| InChIKey | PGDPYCOCJRHDRR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |